C13H16F3N5 — CID 82270418
[2-cyclohexyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-yl]hydrazine (PubChem CID 82270418) has the molecular formula C13H16F3N5 and a molecular weight of 299.30 g/mol. Its IUPAC name is [2-cyclohexyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-yl]hydrazine.
| Compound Name | [2-cyclohexyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-yl]hydrazine |
|---|---|
| PubChem CID | 82270418 |
| Molecular Formula | C13H16F3N5 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [2-cyclohexyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-yl]hydrazine |
| SMILES | NNc1cc(C(F)(F)F)nc2cc(C3CCCCC3)nn12 |
| InChI | InChI=1S/C13H16F3N5/c14-13(15,16)10-7-12(19-17)21-11(18-10)6-9(20-21)8-4-2-1-3-5-8/h6-8,19H,1-5,17H2 |
| InChIKey | FUQICMCLFBHSRO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|