C8H13NO2 — CID 82280202
1-(1-methylpyrrol-3-yl)propane-1,3-diol (PubChem CID 82280202) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 1-(1-methylpyrrol-3-yl)propane-1,3-diol.
| Compound Name | 1-(1-methylpyrrol-3-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 82280202 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 1-(1-methylpyrrol-3-yl)propane-1,3-diol |
| SMILES | Cn1ccc(C(O)CCO)c1 |
| InChI | InChI=1S/C8H13NO2/c1-9-4-2-7(6-9)8(11)3-5-10/h2,4,6,8,10-11H,3,5H2,1H3 |
| InChIKey | ZLIGRBZIADLRDA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |