C11H17NO — CID 82280728
3-amino-2-(2,5-dimethylphenyl)propan-1-ol (PubChem CID 82280728) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 3-amino-2-(2,5-dimethylphenyl)propan-1-ol.
| Compound Name | 3-amino-2-(2,5-dimethylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 82280728 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 3-amino-2-(2,5-dimethylphenyl)propan-1-ol |
| SMILES | Cc1ccc(C)c(C(CN)CO)c1 |
| InChI | InChI=1S/C11H17NO/c1-8-3-4-9(2)11(5-8)10(6-12)7-13/h3-5,10,13H,6-7,12H2,1-2H3 |
| InChIKey | FVLNUALYPWLCKT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |