C11H14ClNO — CID 82284235
6-(3-chlorophenyl)-1,4-oxazepane (PubChem CID 82284235) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-1,4-oxazepane.
| Compound Name | 6-(3-chlorophenyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 82284235 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 6-(3-chlorophenyl)-1,4-oxazepane |
| SMILES | Clc1cccc(C2CNCCOC2)c1 |
| InChI | InChI=1S/C11H14ClNO/c12-11-3-1-2-9(6-11)10-7-13-4-5-14-8-10/h1-3,6,10,13H,4-5,7-8H2 |
| InChIKey | PYHPYRPAVOTUTM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |