C11H11F2N3 — CID 82287061
2-[4-(2,4-difluorophenyl)-1H-imidazol-5-yl]ethanamine (PubChem CID 82287061) has the molecular formula C11H11F2N3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-[4-(2,4-difluorophenyl)-1H-imidazol-5-yl]ethanamine.
| Compound Name | 2-[4-(2,4-difluorophenyl)-1H-imidazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 82287061 |
| Molecular Formula | C11H11F2N3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-[4-(2,4-difluorophenyl)-1H-imidazol-5-yl]ethanamine |
| SMILES | NCCc1[nH]cnc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C11H11F2N3/c12-7-1-2-8(9(13)5-7)11-10(3-4-14)15-6-16-11/h1-2,5-6H,3-4,14H2,(H,15,16) |
| InChIKey | LCNVORSRWUAVKL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |