C11H14ClNO2 — CID 82288111
methyl 2-(4-chloro-3,5-dimethylphenoxy)ethanimidate (PubChem CID 82288111) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is methyl 2-(4-chloro-3,5-dimethylphenoxy)ethanimidate.
| Compound Name | methyl 2-(4-chloro-3,5-dimethylphenoxy)ethanimidate |
|---|---|
| PubChem CID | 82288111 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | methyl 2-(4-chloro-3,5-dimethylphenoxy)ethanimidate |
| SMILES | [H]/N=C(/COc1cc(C)c(Cl)c(C)c1)OC |
| InChI | InChI=1S/C11H14ClNO2/c1-7-4-9(5-8(2)11(7)12)15-6-10(13)14-3/h4-5,13H,6H2,1-3H3/b13-10- |
| InChIKey | KOPQTMZTHGEXAN-RAXLEYEMSA-N |
| XLogP | 2.96 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|