C16H11Cl2N5 — CID 822895
5,7-dichloro-3-[1-(4-methylphenyl)tetrazol-5-yl]-1H-indole (PubChem CID 822895) has the molecular formula C16H11Cl2N5 and a molecular weight of 344.21 g/mol. Its IUPAC name is 5,7-dichloro-3-[1-(4-methylphenyl)tetrazol-5-yl]-1H-indole.
| Compound Name | 5,7-dichloro-3-[1-(4-methylphenyl)tetrazol-5-yl]-1H-indole |
|---|---|
| PubChem CID | 822895 |
| Molecular Formula | C16H11Cl2N5 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 5,7-dichloro-3-[1-(4-methylphenyl)tetrazol-5-yl]-1H-indole |
| SMILES | Cc1ccc(-n2nnnc2-c2c[nH]c3c(Cl)cc(Cl)cc23)cc1 |
| InChI | InChI=1S/C16H11Cl2N5/c1-9-2-4-11(5-3-9)23-16(20-21-22-23)13-8-19-15-12(13)6-10(17)7-14(15)18/h2-8,19H,1H3 |
| InChIKey | JBTIECWFMOJKAQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |