C16H22O2 — CID 82295376
(Z)-3-(2,4-dimethylphenyl)-5,5-dimethylhex-2-enoic acid (PubChem CID 82295376) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (Z)-3-(2,4-dimethylphenyl)-5,5-dimethylhex-2-enoic acid.
| Compound Name | (Z)-3-(2,4-dimethylphenyl)-5,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 82295376 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (Z)-3-(2,4-dimethylphenyl)-5,5-dimethylhex-2-enoic acid |
| SMILES | Cc1ccc(/C(=C\C(=O)O)CC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C16H22O2/c1-11-6-7-14(12(2)8-11)13(9-15(17)18)10-16(3,4)5/h6-9H,10H2,1-5H3,(H,17,18)/b13-9- |
| InChIKey | KXGFPVGLVPVMCC-LCYFTJDESA-N |
| XLogP | 4.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|