C16H26N2 — CID 82295585
2-piperidin-1-yl-1-(2,4,5-trimethylphenyl)ethanamine (PubChem CID 82295585) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 2-piperidin-1-yl-1-(2,4,5-trimethylphenyl)ethanamine.
| Compound Name | 2-piperidin-1-yl-1-(2,4,5-trimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 82295585 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 2-piperidin-1-yl-1-(2,4,5-trimethylphenyl)ethanamine |
| SMILES | Cc1cc(C)c(C(N)CN2CCCCC2)cc1C |
| InChI | InChI=1S/C16H26N2/c1-12-9-14(3)15(10-13(12)2)16(17)11-18-7-5-4-6-8-18/h9-10,16H,4-8,11,17H2,1-3H3 |
| InChIKey | JFLHMFKMJCCUSC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |