C14H20ClNO2 — CID 82305740
2-(5-chloro-2-methoxyphenyl)-3,5,5-trimethylmorpholine (PubChem CID 82305740) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-3,5,5-trimethylmorpholine.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-3,5,5-trimethylmorpholine |
|---|---|
| PubChem CID | 82305740 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-3,5,5-trimethylmorpholine |
| SMILES | COc1ccc(Cl)cc1C1OCC(C)(C)NC1C |
| InChI | InChI=1S/C14H20ClNO2/c1-9-13(18-8-14(2,3)16-9)11-7-10(15)5-6-12(11)17-4/h5-7,9,13,16H,8H2,1-4H3 |
| InChIKey | KGIFRWZUYIWCIB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |