C15H15ClO2S — CID 82307954
5-(3,4-dimethylphenyl)-2-methylbenzenesulfonyl chloride (PubChem CID 82307954) has the molecular formula C15H15ClO2S and a molecular weight of 294.80 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-2-methylbenzenesulfonyl chloride.
| Compound Name | 5-(3,4-dimethylphenyl)-2-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82307954 |
| Molecular Formula | C15H15ClO2S |
| Molecular Weight | 294.80 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-2-methylbenzenesulfonyl chloride |
| SMILES | Cc1ccc(-c2ccc(C)c(S(=O)(=O)Cl)c2)cc1C |
| InChI | InChI=1S/C15H15ClO2S/c1-10-4-6-13(8-12(10)3)14-7-5-11(2)15(9-14)19(16,17)18/h4-9H,1-3H3 |
| InChIKey | KVMQBNWOUZPWBV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.80 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |