C11H14ClN3S — CID 82309547
4-chloro-N-ethyl-6-propan-2-ylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 82309547) has the molecular formula C11H14ClN3S and a molecular weight of 255.77 g/mol. Its IUPAC name is 4-chloro-N-ethyl-6-propan-2-ylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-chloro-N-ethyl-6-propan-2-ylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 82309547 |
| Molecular Formula | C11H14ClN3S |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 4-chloro-N-ethyl-6-propan-2-ylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCNc1nc(Cl)c2cc(C(C)C)sc2n1 |
| InChI | InChI=1S/C11H14ClN3S/c1-4-13-11-14-9(12)7-5-8(6(2)3)16-10(7)15-11/h5-6H,4H2,1-3H3,(H,13,14,15) |
| InChIKey | NWWBTNLUNJQTBW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |