C10H16N2O3 — CID 82328502
3-[cyanomethyl(oxolan-2-ylmethyl)amino]propanoic acid (PubChem CID 82328502) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-[cyanomethyl(oxolan-2-ylmethyl)amino]propanoic acid.
| Compound Name | 3-[cyanomethyl(oxolan-2-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 82328502 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 3-[cyanomethyl(oxolan-2-ylmethyl)amino]propanoic acid |
| SMILES | N#CCN(CCC(=O)O)CC1CCCO1 |
| InChI | InChI=1S/C10H16N2O3/c11-4-6-12(5-3-10(13)14)8-9-2-1-7-15-9/h9H,1-3,5-8H2,(H,13,14) |
| InChIKey | ZAYWOQRIGBLUDL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|