C19H29NO — CID 823348
1-[2-[(3R)-6,6-dimethyl-3-phenyloxan-3-yl]ethyl]pyrrolidine (PubChem CID 823348) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-[2-[(3R)-6,6-dimethyl-3-phenyloxan-3-yl]ethyl]pyrrolidine.
| Compound Name | 1-[2-[(3R)-6,6-dimethyl-3-phenyloxan-3-yl]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 823348 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 1-[2-[(3R)-6,6-dimethyl-3-phenyloxan-3-yl]ethyl]pyrrolidine |
| SMILES | CC1(C)CC[C@@](CCN2CCCC2)(c2ccccc2)CO1 |
| InChI | InChI=1S/C19H29NO/c1-18(2)10-11-19(16-21-18,17-8-4-3-5-9-17)12-15-20-13-6-7-14-20/h3-5,8-9H,6-7,10-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | NMVDSCNOGAKXCC-IBGZPJMESA-N |
| XLogP | 4.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |