C8H8FN3S — CID 82337318
2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol (PubChem CID 82337318) has the molecular formula C8H8FN3S and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol.
| Compound Name | 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol |
|---|---|
| PubChem CID | 82337318 |
| Molecular Formula | C8H8FN3S |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol |
| SMILES | Fc1cnc2nc(CCS)[nH]c2c1 |
| InChI | InChI=1S/C8H8FN3S/c9-5-3-6-8(10-4-5)12-7(11-6)1-2-13/h3-4,13H,1-2H2,(H,10,11,12) |
| InChIKey | GIMGOZUGMRJVCM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|