About 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol
2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol (PubChem CID 82337318) has the molecular formula C8H8FN3S
and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol.
Molecular Properties
| Compound Name | 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol |
| PubChem CID | 82337318 |
| Molecular Formula | C8H8FN3S |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol |
| SMILES | Fc1cnc2nc(CCS)[nH]c2c1 |
| InChI | InChI=1S/C8H8FN3S/c9-5-3-6-8(10-4-5)12-7(11-6)1-2-13/h3-4,13H,1-2H2,(H,10,11,12) |
| InChIKey | GIMGOZUGMRJVCM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol?
The IUPAC name of 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol (CID 82337318) is 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol.
What is the SMILES notation for 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol?
The canonical SMILES for 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol is Fc1cnc2nc(CCS)[nH]c2c1.
What is the InChIKey of 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol?
The InChIKey is GIMGOZUGMRJVCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN3S/c9-5-3-6-8(10-4-5)12-7(11-6)1-2-13/h3-4,13H,1-2H2,(H,10,11,12).
What are the key properties of 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol?
2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol has a molecular weight of 197.24 g/mol, XLogP of 1.57, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)ethanethiol is sourced from PubChem (CID 82337318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).