C11H10N2O3 — CID 82338486
2-[7-(hydroxymethyl)-3-oxo-1,4-benzoxazin-4-yl]acetonitrile (PubChem CID 82338486) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 2-[7-(hydroxymethyl)-3-oxo-1,4-benzoxazin-4-yl]acetonitrile.
| Compound Name | 2-[7-(hydroxymethyl)-3-oxo-1,4-benzoxazin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 82338486 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2-[7-(hydroxymethyl)-3-oxo-1,4-benzoxazin-4-yl]acetonitrile |
| SMILES | N#CCN1C(=O)COc2cc(CO)ccc21 |
| InChI | InChI=1S/C11H10N2O3/c12-3-4-13-9-2-1-8(6-14)5-10(9)16-7-11(13)15/h1-2,5,14H,4,6-7H2 |
| InChIKey | XKDMLSBVVBRTCD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|