C12H10N2O4 — CID 117100107
5-(cyanomethyl)-4-oxo-2,3-dihydro-1,5-benzoxazepine-8-carboxylic acid (PubChem CID 117100107) has the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. Its IUPAC name is 5-(cyanomethyl)-4-oxo-2,3-dihydro-1,5-benzoxazepine-8-carboxylic acid.
| Compound Name | 5-(cyanomethyl)-4-oxo-2,3-dihydro-1,5-benzoxazepine-8-carboxylic acid |
|---|---|
| PubChem CID | 117100107 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 5-(cyanomethyl)-4-oxo-2,3-dihydro-1,5-benzoxazepine-8-carboxylic acid |
| SMILES | N#CCN1C(=O)CCOc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C12H10N2O4/c13-4-5-14-9-2-1-8(12(16)17)7-10(9)18-6-3-11(14)15/h1-2,7H,3,5-6H2,(H,16,17) |
| InChIKey | OXMPOKDUCDYOMD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|