C13H19N3O2S — CID 82341923
3-(4-aminobutyl)-6-propan-2-yl-1H-thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 82341923) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-(4-aminobutyl)-6-propan-2-yl-1H-thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-(4-aminobutyl)-6-propan-2-yl-1H-thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 82341923 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-(4-aminobutyl)-6-propan-2-yl-1H-thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | CC(C)c1cc2c(=O)n(CCCCN)c(=O)[nH]c2s1 |
| InChI | InChI=1S/C13H19N3O2S/c1-8(2)10-7-9-11(19-10)15-13(18)16(12(9)17)6-4-3-5-14/h7-8H,3-6,14H2,1-2H3,(H,15,18) |
| InChIKey | WKLOMNYBEDAXFY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|