C14H17N3O2S — CID 82342162
4-(6-butyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)butanenitrile (PubChem CID 82342162) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 4-(6-butyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)butanenitrile.
| Compound Name | 4-(6-butyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)butanenitrile |
|---|---|
| PubChem CID | 82342162 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 4-(6-butyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)butanenitrile |
| SMILES | CCCCc1cc2c(=O)n(CCCC#N)c(=O)[nH]c2s1 |
| InChI | InChI=1S/C14H17N3O2S/c1-2-3-6-10-9-11-12(20-10)16-14(19)17(13(11)18)8-5-4-7-15/h9H,2-6,8H2,1H3,(H,16,19) |
| InChIKey | MZOSNGCFXXRUKE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|