C9H14N2O2 — CID 82344095
5-amino-N-(2-methylpropyl)furan-2-carboxamide (PubChem CID 82344095) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 5-amino-N-(2-methylpropyl)furan-2-carboxamide.
| Compound Name | 5-amino-N-(2-methylpropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 82344095 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 5-amino-N-(2-methylpropyl)furan-2-carboxamide |
| SMILES | CC(C)CNC(=O)c1ccc(N)o1 |
| InChI | InChI=1S/C9H14N2O2/c1-6(2)5-11-9(12)7-3-4-8(10)13-7/h3-4,6H,5,10H2,1-2H3,(H,11,12) |
| InChIKey | VISVTVQYZRVDLS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |