C7H9N3O3 — CID 83618413
5-amino-N-(2-amino-2-oxoethyl)furan-2-carboxamide (PubChem CID 83618413) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is 5-amino-N-(2-amino-2-oxoethyl)furan-2-carboxamide.
| Compound Name | 5-amino-N-(2-amino-2-oxoethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 83618413 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 5-amino-N-(2-amino-2-oxoethyl)furan-2-carboxamide |
| SMILES | NC(=O)CNC(=O)c1ccc(N)o1 |
| InChI | InChI=1S/C7H9N3O3/c8-5(11)3-10-7(12)4-1-2-6(9)13-4/h1-2H,3,9H2,(H2,8,11)(H,10,12) |
| InChIKey | LTWPRQNDLLJOHF-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |