C16H18N2O4 — CID 82345839
5-[(5-amino-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)methyl]furan-2-carboxylic acid (PubChem CID 82345839) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 5-[(5-amino-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(5-amino-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 82345839 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 5-[(5-amino-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)methyl]furan-2-carboxylic acid |
| SMILES | CC1(C)CN(Cc2ccc(C(=O)O)o2)c2c(N)cccc2O1 |
| InChI | InChI=1S/C16H18N2O4/c1-16(2)9-18(8-10-6-7-13(21-10)15(19)20)14-11(17)4-3-5-12(14)22-16/h3-7H,8-9,17H2,1-2H3,(H,19,20) |
| InChIKey | CVAUJBVQOBMHAL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|