C19H24N2O — CID 82345818
2,2-dimethyl-4-(3-phenylpropyl)-3H-1,4-benzoxazin-5-amine (PubChem CID 82345818) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 2,2-dimethyl-4-(3-phenylpropyl)-3H-1,4-benzoxazin-5-amine.
| Compound Name | 2,2-dimethyl-4-(3-phenylpropyl)-3H-1,4-benzoxazin-5-amine |
|---|---|
| PubChem CID | 82345818 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2,2-dimethyl-4-(3-phenylpropyl)-3H-1,4-benzoxazin-5-amine |
| SMILES | CC1(C)CN(CCCc2ccccc2)c2c(N)cccc2O1 |
| InChI | InChI=1S/C19H24N2O/c1-19(2)14-21(13-7-10-15-8-4-3-5-9-15)18-16(20)11-6-12-17(18)22-19/h3-6,8-9,11-12H,7,10,13-14,20H2,1-2H3 |
| InChIKey | OBWZXIZCWMHPAG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|