C12H26N2O2 — CID 82353089
2-[2-(ethylamino)ethoxy]-N,N-dipropylacetamide (PubChem CID 82353089) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-[2-(ethylamino)ethoxy]-N,N-dipropylacetamide.
| Compound Name | 2-[2-(ethylamino)ethoxy]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 82353089 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-[2-(ethylamino)ethoxy]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)COCCNCC |
| InChI | InChI=1S/C12H26N2O2/c1-4-8-14(9-5-2)12(15)11-16-10-7-13-6-3/h13H,4-11H2,1-3H3 |
| InChIKey | SSWIYRJMFXCWDF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|