C17H18N4O — CID 82355591
[3-[(2,5-dimethylphenyl)diazenyl]-2-methylimidazo[1,2-a]pyridin-6-yl]methanol (PubChem CID 82355591) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is [3-[(2,5-dimethylphenyl)diazenyl]-2-methylimidazo[1,2-a]pyridin-6-yl]methanol.
| Compound Name | [3-[(2,5-dimethylphenyl)diazenyl]-2-methylimidazo[1,2-a]pyridin-6-yl]methanol |
|---|---|
| PubChem CID | 82355591 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [3-[(2,5-dimethylphenyl)diazenyl]-2-methylimidazo[1,2-a]pyridin-6-yl]methanol |
| SMILES | Cc1ccc(C)c(/N=N/c2c(C)nc3ccc(CO)cn23)c1 |
| InChI | InChI=1S/C17H18N4O/c1-11-4-5-12(2)15(8-11)19-20-17-13(3)18-16-7-6-14(10-22)9-21(16)17/h4-9,22H,10H2,1-3H3/b20-19+ |
| InChIKey | DVCBABHKPRBOJT-FMQUCBEESA-N |
| XLogP | 4.17 |
| TPSA | 62.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|