C16H23N3O2 — CID 82359619
methyl 2-[2-(ethylamino)-5,6-dimethylbenzimidazol-1-yl]butanoate (PubChem CID 82359619) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is methyl 2-[2-(ethylamino)-5,6-dimethylbenzimidazol-1-yl]butanoate.
| Compound Name | methyl 2-[2-(ethylamino)-5,6-dimethylbenzimidazol-1-yl]butanoate |
|---|---|
| PubChem CID | 82359619 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | methyl 2-[2-(ethylamino)-5,6-dimethylbenzimidazol-1-yl]butanoate |
| SMILES | CCNc1nc2cc(C)c(C)cc2n1C(CC)C(=O)OC |
| InChI | InChI=1S/C16H23N3O2/c1-6-13(15(20)21-5)19-14-9-11(4)10(3)8-12(14)18-16(19)17-7-2/h8-9,13H,6-7H2,1-5H3,(H,17,18) |
| InChIKey | IDSYSTXMEFSVDU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |