C16H23N3O2 — CID 82359022
butan-2-yl 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)propanoate (PubChem CID 82359022) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is butan-2-yl 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)propanoate.
| Compound Name | butan-2-yl 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)propanoate |
|---|---|
| PubChem CID | 82359022 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | butan-2-yl 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)propanoate |
| SMILES | CCC(C)OC(=O)C(C)n1c(N)nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C16H23N3O2/c1-6-11(4)21-15(20)12(5)19-14-8-10(3)9(2)7-13(14)18-16(19)17/h7-8,11-12H,6H2,1-5H3,(H2,17,18) |
| InChIKey | GWMOWQNNOXIDDO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |