C11H19N5 — CID 82365240
1-pentyl-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine (PubChem CID 82365240) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 1-pentyl-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-pentyl-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 82365240 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1-pentyl-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CCCCCN1CCC=C(c2nn[nH]n2)C1 |
| InChI | InChI=1S/C11H19N5/c1-2-3-4-7-16-8-5-6-10(9-16)11-12-14-15-13-11/h6H,2-5,7-9H2,1H3,(H,12,13,14,15) |
| InChIKey | RRVSSBAEUHXZQG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|