C14H19NO2S — CID 82368797
N,N-diethyl-3-methyl-4-prop-2-ynylsulfonylaniline (PubChem CID 82368797) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is N,N-diethyl-3-methyl-4-prop-2-ynylsulfonylaniline.
| Compound Name | N,N-diethyl-3-methyl-4-prop-2-ynylsulfonylaniline |
|---|---|
| PubChem CID | 82368797 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N,N-diethyl-3-methyl-4-prop-2-ynylsulfonylaniline |
| SMILES | C#CCS(=O)(=O)c1ccc(N(CC)CC)cc1C |
| InChI | InChI=1S/C14H19NO2S/c1-5-10-18(16,17)14-9-8-13(11-12(14)4)15(6-2)7-3/h1,8-9,11H,6-7,10H2,2-4H3 |
| InChIKey | XCYHIGRPHQYPIC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|