C10H3ClN4O5 — CID 82369524
3-(2-chloro-4-nitrophenyl)furo[3,4-d]triazole-4,6-dione (PubChem CID 82369524) has the molecular formula C10H3ClN4O5 and a molecular weight of 294.61 g/mol. Its IUPAC name is 3-(2-chloro-4-nitrophenyl)furo[3,4-d]triazole-4,6-dione.
| Compound Name | 3-(2-chloro-4-nitrophenyl)furo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 82369524 |
| Molecular Formula | C10H3ClN4O5 |
| Molecular Weight | 294.61 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 3-(2-chloro-4-nitrophenyl)furo[3,4-d]triazole-4,6-dione |
| SMILES | O=C1OC(=O)c2c1nnn2-c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C10H3ClN4O5/c11-5-3-4(15(18)19)1-2-6(5)14-8-7(12-13-14)9(16)20-10(8)17/h1-3H |
| InChIKey | DKUPYKLTIRJKKQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 117.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.61 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|