C8H8FNO — CID 82373061
4-fluoro-2,3-dihydro-1-benzofuran-5-amine (PubChem CID 82373061) has the molecular formula C8H8FNO and a molecular weight of 153.16 g/mol. Its IUPAC name is 4-fluoro-2,3-dihydro-1-benzofuran-5-amine.
| Compound Name | 4-fluoro-2,3-dihydro-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 82373061 |
| Molecular Formula | C8H8FNO |
| Molecular Weight | 153.16 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 4-fluoro-2,3-dihydro-1-benzofuran-5-amine |
| SMILES | Nc1ccc2c(c1F)CCO2 |
| InChI | InChI=1S/C8H8FNO/c9-8-5-3-4-11-7(5)2-1-6(8)10/h1-2H,3-4,10H2 |
| InChIKey | JFNKDYUILPSNTH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.16 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|