C10H10N2O — CID 82411466
2,6-dihydro-1H-furo[3,2-e]indol-8-amine (PubChem CID 82411466) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 2,6-dihydro-1H-furo[3,2-e]indol-8-amine.
| Compound Name | 2,6-dihydro-1H-furo[3,2-e]indol-8-amine |
|---|---|
| PubChem CID | 82411466 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 2,6-dihydro-1H-furo[3,2-e]indol-8-amine |
| SMILES | Nc1c[nH]c2ccc3c(c12)CCO3 |
| InChI | InChI=1S/C10H10N2O/c11-7-5-12-8-1-2-9-6(10(7)8)3-4-13-9/h1-2,5,12H,3-4,11H2 |
| InChIKey | UFQJZRAOPZAZPX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |