C12H9NO4 — CID 172700001
9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid (PubChem CID 172700001) has the molecular formula C12H9NO4 and a molecular weight of 231.21 g/mol. Its IUPAC name is 9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid.
| Compound Name | 9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 172700001 |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c2ccc3c(c2c1=O)CCO3 |
| InChI | InChI=1S/C12H9NO4/c14-11-7(12(15)16)5-13-8-1-2-9-6(10(8)11)3-4-17-9/h1-2,5H,3-4H2,(H,13,14)(H,15,16) |
| InChIKey | CVIJSZHAJAJGDN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |