9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid

C12H9NO4 — CID 172700001

IUPAC9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid
SMILESO=C(O)c1c[nH]c2ccc3c(c2c1=O)CCO3
InChIInChI=1S/C12H9NO4/c14-11-7(12(15)16)5-13-8-1-2-9-6(10(8)11)3-4-17-9/h1-2,5H,3-4H2,(H,13,14)(H,15,16)
InChIKeyCVIJSZHAJAJGDN-UHFFFAOYSA-N
MW231.21 g/mol
LogP1.16
Rot. Bonds1

About 9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid

9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid (PubChem CID 172700001) has the molecular formula C12H9NO4 and a molecular weight of 231.21 g/mol. Its IUPAC name is 9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid.

Molecular Properties

Compound Name9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid
PubChem CID172700001
Molecular FormulaC12H9NO4
Molecular Weight231.21 g/mol
Exact Mass231.05
IUPAC Name9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid
SMILESO=C(O)c1c[nH]c2ccc3c(c2c1=O)CCO3
InChIInChI=1S/C12H9NO4/c14-11-7(12(15)16)5-13-8-1-2-9-6(10(8)11)3-4-17-9/h1-2,5H,3-4H2,(H,13,14)(H,15,16)
InChIKeyCVIJSZHAJAJGDN-UHFFFAOYSA-N
XLogP1.16
TPSA79.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.21
LogP ≤ 51.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid?
The IUPAC name of 9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid (CID 172700001) is 9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid.
What is the SMILES notation for 9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid?
The canonical SMILES for 9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid is O=C(O)c1c[nH]c2ccc3c(c2c1=O)CCO3.
What is the InChIKey of 9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid?
The InChIKey is CVIJSZHAJAJGDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO4/c14-11-7(12(15)16)5-13-8-1-2-9-6(10(8)11)3-4-17-9/h1-2,5H,3-4H2,(H,13,14)(H,15,16).
What are the key properties of 9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid?
9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid has a molecular weight of 231.21 g/mol, XLogP of 1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxo-2,6-dihydro-1H-furo[3,2-f]quinoline-8-carboxylic acid is sourced from PubChem (CID 172700001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).