C8H6FIO — CID 176929193
4-fluoro-5-iodo-2,3-dihydro-1-benzofuran (PubChem CID 176929193) has the molecular formula C8H6FIO and a molecular weight of 264.04 g/mol. Its IUPAC name is 4-fluoro-5-iodo-2,3-dihydro-1-benzofuran.
| Compound Name | 4-fluoro-5-iodo-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 176929193 |
| Molecular Formula | C8H6FIO |
| Molecular Weight | 264.04 g/mol |
| Exact Mass | 263.94 |
| IUPAC Name | 4-fluoro-5-iodo-2,3-dihydro-1-benzofuran |
| SMILES | Fc1c(I)ccc2c1CCO2 |
| InChI | InChI=1S/C8H6FIO/c9-8-5-3-4-11-7(5)2-1-6(8)10/h1-2H,3-4H2 |
| InChIKey | RWWAHIZAFXCWJH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.04 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|