C9H9ClO — CID 89474128
4-chloro-5-methyl-2,3-dihydro-1-benzofuran (PubChem CID 89474128) has the molecular formula C9H9ClO and a molecular weight of 168.62 g/mol. Its IUPAC name is 4-chloro-5-methyl-2,3-dihydro-1-benzofuran.
| Compound Name | 4-chloro-5-methyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 89474128 |
| Molecular Formula | C9H9ClO |
| Molecular Weight | 168.62 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | 4-chloro-5-methyl-2,3-dihydro-1-benzofuran |
| SMILES | Cc1ccc2c(c1Cl)CCO2 |
| InChI | InChI=1S/C9H9ClO/c1-6-2-3-8-7(9(6)10)4-5-11-8/h2-3H,4-5H2,1H3 |
| InChIKey | QMIKWZSMUHQOOR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.62 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |