About 6,7-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;methane
6,7-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;methane (PubChem CID 143804420) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 6,7-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;methane.
Analyze 6,7-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;methane?
The IUPAC name of 6,7-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;methane (CID 143804420) is 6,7-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;methane.
What is the SMILES notation for 6,7-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;methane?
The canonical SMILES for 6,7-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;methane is C.Cc1ccc2c(c1C)CCCCO2.
What is the InChIKey of 6,7-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;methane?
The InChIKey is IOGLZDKKOFCLAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O.CH4/c1-9-6-7-12-11(10(9)2)5-3-4-8-13-12;/h6-7H,3-5,8H2,1-2H3;1H4.
What are the key properties of 6,7-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;methane?
6,7-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;methane has a molecular weight of 192.30 g/mol, XLogP of 3.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;methane is sourced from PubChem (CID 143804420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).