C13H19ClO — CID 143804461
5-chloro-6-methyl-3,4-dihydro-2H-chromene;propane (PubChem CID 143804461) has the molecular formula C13H19ClO and a molecular weight of 226.75 g/mol. Its IUPAC name is 5-chloro-6-methyl-3,4-dihydro-2H-chromene;propane.
| Compound Name | 5-chloro-6-methyl-3,4-dihydro-2H-chromene;propane |
|---|---|
| PubChem CID | 143804461 |
| Molecular Formula | C13H19ClO |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 5-chloro-6-methyl-3,4-dihydro-2H-chromene;propane |
| SMILES | CCC.Cc1ccc2c(c1Cl)CCCO2 |
| InChI | InChI=1S/C10H11ClO.C3H8/c1-7-4-5-9-8(10(7)11)3-2-6-12-9;1-3-2/h4-5H,2-3,6H2,1H3;3H2,1-2H3 |
| InChIKey | LDWRQXFVCACVPM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |