About (5-bromo-3,4-dihydro-2H-chromen-6-yl)methanol
(5-bromo-3,4-dihydro-2H-chromen-6-yl)methanol (PubChem CID 134205972) has the molecular formula C10H11BrO2
and a molecular weight of 243.10 g/mol. Its IUPAC name is (5-bromo-3,4-dihydro-2H-chromen-6-yl)methanol.
Molecular Properties
| Compound Name | (5-bromo-3,4-dihydro-2H-chromen-6-yl)methanol |
| PubChem CID | 134205972 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | (5-bromo-3,4-dihydro-2H-chromen-6-yl)methanol |
| SMILES | OCc1ccc2c(c1Br)CCCO2 |
| InChI | InChI=1S/C10H11BrO2/c11-10-7(6-12)3-4-9-8(10)2-1-5-13-9/h3-4,12H,1-2,5-6H2 |
| InChIKey | CYADBFOGAAHPSQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-bromo-3,4-dihydro-2H-chromen-6-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-3,4-dihydro-2H-chromen-6-yl)methanol?
The IUPAC name of (5-bromo-3,4-dihydro-2H-chromen-6-yl)methanol (CID 134205972) is (5-bromo-3,4-dihydro-2H-chromen-6-yl)methanol.
What is the SMILES notation for (5-bromo-3,4-dihydro-2H-chromen-6-yl)methanol?
The canonical SMILES for (5-bromo-3,4-dihydro-2H-chromen-6-yl)methanol is OCc1ccc2c(c1Br)CCCO2.
What is the InChIKey of (5-bromo-3,4-dihydro-2H-chromen-6-yl)methanol?
The InChIKey is CYADBFOGAAHPSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO2/c11-10-7(6-12)3-4-9-8(10)2-1-5-13-9/h3-4,12H,1-2,5-6H2.
What are the key properties of (5-bromo-3,4-dihydro-2H-chromen-6-yl)methanol?
(5-bromo-3,4-dihydro-2H-chromen-6-yl)methanol has a molecular weight of 243.10 g/mol, XLogP of 2.27, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-3,4-dihydro-2H-chromen-6-yl)methanol is sourced from PubChem (CID 134205972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).