C11H14N2O2 — CID 139790845
5-methyl-3,4-dihydro-2H-chromene-6-carbohydrazide (PubChem CID 139790845) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 5-methyl-3,4-dihydro-2H-chromene-6-carbohydrazide.
| Compound Name | 5-methyl-3,4-dihydro-2H-chromene-6-carbohydrazide |
|---|---|
| PubChem CID | 139790845 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 5-methyl-3,4-dihydro-2H-chromene-6-carbohydrazide |
| SMILES | Cc1c(C(=O)NN)ccc2c1CCCO2 |
| InChI | InChI=1S/C11H14N2O2/c1-7-8-3-2-6-15-10(8)5-4-9(7)11(14)13-12/h4-5H,2-3,6,12H2,1H3,(H,13,14) |
| InChIKey | UHICPIWNHJHIOM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|