C10H9N3O3 — CID 121216139
7-cyano-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide (PubChem CID 121216139) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 7-cyano-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide.
| Compound Name | 7-cyano-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 121216139 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 7-cyano-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| SMILES | N#Cc1cc2c(cc1C(=O)NN)OCCO2 |
| InChI | InChI=1S/C10H9N3O3/c11-5-6-3-8-9(16-2-1-15-8)4-7(6)10(14)13-12/h3-4H,1-2,12H2,(H,13,14) |
| InChIKey | QLKGGOOVPRTECF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|