C13H18O — CID 88975705
4-butan-2-yl-5-methyl-2,3-dihydro-1-benzofuran (PubChem CID 88975705) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-butan-2-yl-5-methyl-2,3-dihydro-1-benzofuran.
| Compound Name | 4-butan-2-yl-5-methyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 88975705 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 4-butan-2-yl-5-methyl-2,3-dihydro-1-benzofuran |
| SMILES | CCC(C)c1c(C)ccc2c1CCO2 |
| InChI | InChI=1S/C13H18O/c1-4-9(2)13-10(3)5-6-12-11(13)7-8-14-12/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | PMWUCFUGHUXJEN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |