C12H16O — CID 144643347
4-butan-2-yl-2,3-dihydro-1-benzofuran (PubChem CID 144643347) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-butan-2-yl-2,3-dihydro-1-benzofuran.
| Compound Name | 4-butan-2-yl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 144643347 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 4-butan-2-yl-2,3-dihydro-1-benzofuran |
| SMILES | CCC(C)c1cccc2c1CCO2 |
| InChI | InChI=1S/C12H16O/c1-3-9(2)10-5-4-6-12-11(10)7-8-13-12/h4-6,9H,3,7-8H2,1-2H3 |
| InChIKey | HGUSRVKZGNJZQK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |