C9H9BrO — CID 139534248
4-(bromomethyl)-2,3-dihydro-1-benzofuran (PubChem CID 139534248) has the molecular formula C9H9BrO and a molecular weight of 213.07 g/mol. Its IUPAC name is 4-(bromomethyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 4-(bromomethyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 139534248 |
| Molecular Formula | C9H9BrO |
| Molecular Weight | 213.07 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 4-(bromomethyl)-2,3-dihydro-1-benzofuran |
| SMILES | BrCc1cccc2c1CCO2 |
| InChI | InChI=1S/C9H9BrO/c10-6-7-2-1-3-9-8(7)4-5-11-9/h1-3H,4-6H2 |
| InChIKey | OTBKHLGFLIDKHD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.07 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|