C19H22O4 — CID 102092946
4,18-dimethyl-8,14-dioxatricyclo[13.4.0.02,7]nonadeca-1(15),2(7),3,5,16,18-hexaene-3,19-diol (PubChem CID 102092946) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 4,18-dimethyl-8,14-dioxatricyclo[13.4.0.02,7]nonadeca-1(15),2(7),3,5,16,18-hexaene-3,19-diol.
| Compound Name | 4,18-dimethyl-8,14-dioxatricyclo[13.4.0.02,7]nonadeca-1(15),2(7),3,5,16,18-hexaene-3,19-diol |
|---|---|
| PubChem CID | 102092946 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 4,18-dimethyl-8,14-dioxatricyclo[13.4.0.02,7]nonadeca-1(15),2(7),3,5,16,18-hexaene-3,19-diol |
| SMILES | Cc1ccc2c(c1O)-c1c(ccc(C)c1O)OCCCCCO2 |
| InChI | InChI=1S/C19H22O4/c1-12-6-8-14-16(18(12)20)17-15(9-7-13(2)19(17)21)23-11-5-3-4-10-22-14/h6-9,20-21H,3-5,10-11H2,1-2H3 |
| InChIKey | QAYZZTKECAVXFH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |