C16H26B2O6 — CID 10947667
(17-borono-2,13-dioxabicyclo[12.2.2]octadeca-1(17),14(18),15-trien-15-yl)boronic acid (PubChem CID 10947667) has the molecular formula C16H26B2O6 and a molecular weight of 336.00 g/mol. Its IUPAC name is (17-borono-2,13-dioxabicyclo[12.2.2]octadeca-1(17),14(18),15-trien-15-yl)boronic acid.
| Compound Name | (17-borono-2,13-dioxabicyclo[12.2.2]octadeca-1(17),14(18),15-trien-15-yl)boronic acid |
|---|---|
| PubChem CID | 10947667 |
| Molecular Formula | C16H26B2O6 |
| Molecular Weight | 336.00 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (17-borono-2,13-dioxabicyclo[12.2.2]octadeca-1(17),14(18),15-trien-15-yl)boronic acid |
| SMILES | OB(O)c1cc2c(B(O)O)cc1OCCCCCCCCCCO2 |
| InChI | InChI=1S/C16H26B2O6/c19-17(20)13-12-16-14(18(21)22)11-15(13)23-9-7-5-3-1-2-4-6-8-10-24-16/h11-12,19-22H,1-10H2 |
| InChIKey | IWPRAEDNMFKODW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.00 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|