C8H8ClIN2O — CID 153376900
1-(5-chloro-2,3-dihydro-1-benzofuran-4-yl)-1-iodohydrazine (PubChem CID 153376900) has the molecular formula C8H8ClIN2O and a molecular weight of 310.52 g/mol. Its IUPAC name is 1-(5-chloro-2,3-dihydro-1-benzofuran-4-yl)-1-iodohydrazine.
| Compound Name | 1-(5-chloro-2,3-dihydro-1-benzofuran-4-yl)-1-iodohydrazine |
|---|---|
| PubChem CID | 153376900 |
| Molecular Formula | C8H8ClIN2O |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 309.94 |
| IUPAC Name | 1-(5-chloro-2,3-dihydro-1-benzofuran-4-yl)-1-iodohydrazine |
| SMILES | NN(I)c1c(Cl)ccc2c1CCO2 |
| InChI | InChI=1S/C8H8ClIN2O/c9-6-1-2-7-5(3-4-13-7)8(6)12(10)11/h1-2H,3-4,11H2 |
| InChIKey | YAWBCSSJLCWQMN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|