About 9-bromo-1,2-dihydrobenzo[e][1]benzofuran
9-bromo-1,2-dihydrobenzo[e][1]benzofuran (PubChem CID 171477282) has the molecular formula C12H9BrO
and a molecular weight of 249.11 g/mol. Its IUPAC name is 9-bromo-1,2-dihydrobenzo[e][1]benzofuran.
Molecular Properties
| Compound Name | 9-bromo-1,2-dihydrobenzo[e][1]benzofuran |
| PubChem CID | 171477282 |
| Molecular Formula | C12H9BrO |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 9-bromo-1,2-dihydrobenzo[e][1]benzofuran |
| SMILES | Brc1cccc2ccc3c(c12)CCO3 |
| InChI | InChI=1S/C12H9BrO/c13-10-3-1-2-8-4-5-11-9(12(8)10)6-7-14-11/h1-5H,6-7H2 |
| InChIKey | UEMGSDVWJAJWAH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-bromo-1,2-dihydrobenzo[e][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-1,2-dihydrobenzo[e][1]benzofuran?
The IUPAC name of 9-bromo-1,2-dihydrobenzo[e][1]benzofuran (CID 171477282) is 9-bromo-1,2-dihydrobenzo[e][1]benzofuran.
What is the SMILES notation for 9-bromo-1,2-dihydrobenzo[e][1]benzofuran?
The canonical SMILES for 9-bromo-1,2-dihydrobenzo[e][1]benzofuran is Brc1cccc2ccc3c(c12)CCO3.
What is the InChIKey of 9-bromo-1,2-dihydrobenzo[e][1]benzofuran?
The InChIKey is UEMGSDVWJAJWAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrO/c13-10-3-1-2-8-4-5-11-9(12(8)10)6-7-14-11/h1-5H,6-7H2.
What are the key properties of 9-bromo-1,2-dihydrobenzo[e][1]benzofuran?
9-bromo-1,2-dihydrobenzo[e][1]benzofuran has a molecular weight of 249.11 g/mol, XLogP of 3.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-1,2-dihydrobenzo[e][1]benzofuran is sourced from PubChem (CID 171477282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).