C9H8N2O — CID 21196798
7,8-dihydro-1H-furo[2,3-g]indazole (PubChem CID 21196798) has the molecular formula C9H8N2O and a molecular weight of 160.18 g/mol. Its IUPAC name is 7,8-dihydro-1H-furo[2,3-g]indazole.
| Compound Name | 7,8-dihydro-1H-furo[2,3-g]indazole |
|---|---|
| PubChem CID | 21196798 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 7,8-dihydro-1H-furo[2,3-g]indazole |
| SMILES | c1cc2cn[nH]c2c2c1OCC2 |
| InChI | InChI=1S/C9H8N2O/c1-2-8-7(3-4-12-8)9-6(1)5-10-11-9/h1-2,5H,3-4H2,(H,10,11) |
| InChIKey | YFHBYONYIMMCKG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |