C13H17NO2 — CID 145326203
ethane;9-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-e]indole (PubChem CID 145326203) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is ethane;9-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-e]indole.
| Compound Name | ethane;9-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-e]indole |
|---|---|
| PubChem CID | 145326203 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | ethane;9-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-e]indole |
| SMILES | CC.Cc1c[nH]c2ccc3c(c12)OCCO3 |
| InChI | InChI=1S/C11H11NO2.C2H6/c1-7-6-12-8-2-3-9-11(10(7)8)14-5-4-13-9;1-2/h2-3,6,12H,4-5H2,1H3;1-2H3 |
| InChIKey | QCXNNLYFOXVSKS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |