C7H9N3O2 — CID 82373309
3-methyl-4,5,7,8-tetrahydro-[1,2]oxazolo[4,3-e][1,4]diazepin-6-one (PubChem CID 82373309) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is 3-methyl-4,5,7,8-tetrahydro-[1,2]oxazolo[4,3-e][1,4]diazepin-6-one.
| Compound Name | 3-methyl-4,5,7,8-tetrahydro-[1,2]oxazolo[4,3-e][1,4]diazepin-6-one |
|---|---|
| PubChem CID | 82373309 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 3-methyl-4,5,7,8-tetrahydro-[1,2]oxazolo[4,3-e][1,4]diazepin-6-one |
| SMILES | Cc1onc2c1NCC(=O)NC2 |
| InChI | InChI=1S/C7H9N3O2/c1-4-7-5(10-12-4)2-8-6(11)3-9-7/h9H,2-3H2,1H3,(H,8,11) |
| InChIKey | MBXRRXLYBDPSSJ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |